C12H14BrN3O5S — CID 108571899
5-bromo-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]furan-2-carboxamide (PubChem CID 108571899) has the molecular formula C12H14BrN3O5S and a molecular weight of 392.23 g/mol. Its IUPAC name is 5-bromo-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 108571899 |
| Molecular Formula | C12H14BrN3O5S |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 5-bromo-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]furan-2-carboxamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H14BrN3O5S/c1-7-11(8(2)21-16-7)22(18,19)15-6-5-14-12(17)9-3-4-10(13)20-9/h3-4,15H,5-6H2,1-2H3,(H,14,17) |
| InChIKey | ATUCAICRFVDFGJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|