C8H16ClN3O3S — CID 119972982
3,5-dimethyl-N-[2-(methylamino)ethyl]-1,2-oxazole-4-sulfonamide;hydrochloride (PubChem CID 119972982) has the molecular formula C8H16ClN3O3S and a molecular weight of 269.75 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(methylamino)ethyl]-1,2-oxazole-4-sulfonamide;hydrochloride.
| Compound Name | 3,5-dimethyl-N-[2-(methylamino)ethyl]-1,2-oxazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119972982 |
| Molecular Formula | C8H16ClN3O3S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 3,5-dimethyl-N-[2-(methylamino)ethyl]-1,2-oxazole-4-sulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1c(C)noc1C.Cl |
| InChI | InChI=1S/C8H15N3O3S.ClH/c1-6-8(7(2)14-11-6)15(12,13)10-5-4-9-3;/h9-10H,4-5H2,1-3H3;1H |
| InChIKey | XWPFEISQBFUGSS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|