C8H15N3O5S2 — CID 61131991
3,5-dimethyl-N-(3-sulfamoylpropyl)-1,2-oxazole-4-sulfonamide (PubChem CID 61131991) has the molecular formula C8H15N3O5S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3,5-dimethyl-N-(3-sulfamoylpropyl)-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(3-sulfamoylpropyl)-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 61131991 |
| Molecular Formula | C8H15N3O5S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3,5-dimethyl-N-(3-sulfamoylpropyl)-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C8H15N3O5S2/c1-6-8(7(2)16-11-6)18(14,15)10-4-3-5-17(9,12)13/h10H,3-5H2,1-2H3,(H2,9,12,13) |
| InChIKey | YSCSETVCTPFHKP-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|