C12H22N2O4S — CID 32937382
N-(3-butoxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 32937382) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is N-(3-butoxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(3-butoxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 32937382 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-(3-butoxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | CCCCOCCCNS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C12H22N2O4S/c1-4-5-8-17-9-6-7-13-19(15,16)12-10(2)14-18-11(12)3/h13H,4-9H2,1-3H3 |
| InChIKey | HBMSECHLKBORNI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|