C9H16N2O4S — CID 3452396
N-(2-ethoxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 3452396) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 3452396 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-(2-ethoxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C9H16N2O4S/c1-4-14-6-5-10-16(12,13)9-7(2)11-15-8(9)3/h10H,4-6H2,1-3H3 |
| InChIKey | LMVYNEHQDSSIQW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|