C11H19N3O5S — CID 108574145
N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-3-methoxypropanamide (PubChem CID 108574145) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-3-methoxypropanamide.
| Compound Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 108574145 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NCCNS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C11H19N3O5S/c1-8-11(9(2)19-14-8)20(16,17)13-6-5-12-10(15)4-7-18-3/h13H,4-7H2,1-3H3,(H,12,15) |
| InChIKey | ZEFBSBNPOLYUMD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|