C17H23N3O6S — CID 108572427
N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-(2-ethoxyphenoxy)acetamide (PubChem CID 108572427) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-(2-ethoxyphenoxy)acetamide.
| Compound Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-(2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 108572427 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-(2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)NCCNS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C17H23N3O6S/c1-4-24-14-7-5-6-8-15(14)25-11-16(21)18-9-10-19-27(22,23)17-12(2)20-26-13(17)3/h5-8,19H,4,9-11H2,1-3H3,(H,18,21) |
| InChIKey | VOUMSMARQASXAC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|