C14H17FN2O4S — CID 39666367
N-[3-(2-fluorophenoxy)propyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 39666367) has the molecular formula C14H17FN2O4S and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[3-(2-fluorophenoxy)propyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[3-(2-fluorophenoxy)propyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 39666367 |
| Molecular Formula | C14H17FN2O4S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-[3-(2-fluorophenoxy)propyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCCOc1ccccc1F |
| InChI | InChI=1S/C14H17FN2O4S/c1-10-14(11(2)21-17-10)22(18,19)16-8-5-9-20-13-7-4-3-6-12(13)15/h3-4,6-7,16H,5,8-9H2,1-2H3 |
| InChIKey | JWUDTCNHLBZOBO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|