C17H22FN3O3 — CID 95904909
1-[(1R)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[3-(2-fluorophenoxy)propyl]urea (PubChem CID 95904909) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[(1R)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[3-(2-fluorophenoxy)propyl]urea.
| Compound Name | 1-[(1R)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[3-(2-fluorophenoxy)propyl]urea |
|---|---|
| PubChem CID | 95904909 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[(1R)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-[3-(2-fluorophenoxy)propyl]urea |
| SMILES | Cc1noc(C)c1[C@@H](C)NC(=O)NCCCOc1ccccc1F |
| InChI | InChI=1S/C17H22FN3O3/c1-11(16-12(2)21-24-13(16)3)20-17(22)19-9-6-10-23-15-8-5-4-7-14(15)18/h4-5,7-8,11H,6,9-10H2,1-3H3,(H2,19,20,22)/t11-/m1/s1 |
| InChIKey | DEWVJQRBHMLCTM-LLVKDONJSA-N |
| XLogP | 3.26 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|