C13H22N2O4S — CID 48945511
N-(3-cyclopentyloxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 48945511) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 48945511 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCCOC1CCCC1 |
| InChI | InChI=1S/C13H22N2O4S/c1-10-13(11(2)19-15-10)20(16,17)14-8-5-9-18-12-6-3-4-7-12/h12,14H,3-9H2,1-2H3 |
| InChIKey | JVMHETNFSNNYNF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|