C14H16IN3O4S — CID 108571226
N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-iodobenzamide (PubChem CID 108571226) has the molecular formula C14H16IN3O4S and a molecular weight of 449.27 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-iodobenzamide.
| Compound Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 108571226 |
| Molecular Formula | C14H16IN3O4S |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]-2-iodobenzamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCNC(=O)c1ccccc1I |
| InChI | InChI=1S/C14H16IN3O4S/c1-9-13(10(2)22-18-9)23(20,21)17-8-7-16-14(19)11-5-3-4-6-12(11)15/h3-6,17H,7-8H2,1-2H3,(H,16,19) |
| InChIKey | WJAPAGUOMZQHJQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|