C10H18N2O4S2 — CID 103834780
N-[2-(3-hydroxypropylsulfanyl)ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 103834780) has the molecular formula C10H18N2O4S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 103834780 |
| Molecular Formula | C10H18N2O4S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCSCCCO |
| InChI | InChI=1S/C10H18N2O4S2/c1-8-10(9(2)16-12-8)18(14,15)11-4-7-17-6-3-5-13/h11,13H,3-7H2,1-2H3 |
| InChIKey | RDAVYWYWOBJURJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|