C11H17NO5S3 — CID 106305301
3-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]-4-methylthiophene-2-carboxylic acid (PubChem CID 106305301) has the molecular formula C11H17NO5S3 and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106305301 |
| Molecular Formula | C11H17NO5S3 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-[2-(3-hydroxypropylsulfanyl)ethylsulfamoyl]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)NCCSCCCO |
| InChI | InChI=1S/C11H17NO5S3/c1-8-7-19-9(11(14)15)10(8)20(16,17)12-3-6-18-5-2-4-13/h7,12-13H,2-6H2,1H3,(H,14,15) |
| InChIKey | AMOBJLOUGJWWFY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|