C9H12N2O6S2 — CID 102749185
3-(2-carbamoyloxyethylsulfamoyl)-4-methylthiophene-2-carboxylic acid (PubChem CID 102749185) has the molecular formula C9H12N2O6S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-(2-carbamoyloxyethylsulfamoyl)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-(2-carbamoyloxyethylsulfamoyl)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102749185 |
| Molecular Formula | C9H12N2O6S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 3-(2-carbamoyloxyethylsulfamoyl)-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)NCCOC(N)=O |
| InChI | InChI=1S/C9H12N2O6S2/c1-5-4-18-6(8(12)13)7(5)19(15,16)11-2-3-17-9(10)14/h4,11H,2-3H2,1H3,(H2,10,14)(H,12,13) |
| InChIKey | RXQTZOBUTFEWGU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|