C10H13NO7S2 — CID 102747994
3-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid (PubChem CID 102747994) has the molecular formula C10H13NO7S2 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102747994 |
| Molecular Formula | C10H13NO7S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-[(3-hydroxy-1-methoxy-1-oxopropan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid |
| SMILES | COC(=O)C(CO)NS(=O)(=O)c1c(C)csc1C(=O)O |
| InChI | InChI=1S/C10H13NO7S2/c1-5-4-19-7(9(13)14)8(5)20(16,17)11-6(3-12)10(15)18-2/h4,6,11-12H,3H2,1-2H3,(H,13,14) |
| InChIKey | RPZCYHSRQVTMGJ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |