C14H23NO4S2 — CID 102748162
4-methyl-3-(octan-2-ylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 102748162) has the molecular formula C14H23NO4S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-methyl-3-(octan-2-ylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-(octan-2-ylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102748162 |
| Molecular Formula | C14H23NO4S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-methyl-3-(octan-2-ylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | CCCCCCC(C)NS(=O)(=O)c1c(C)csc1C(=O)O |
| InChI | InChI=1S/C14H23NO4S2/c1-4-5-6-7-8-11(3)15-21(18,19)13-10(2)9-20-12(13)14(16)17/h9,11,15H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | OPKGFEMEODBNFI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|