C11H17NO5S2 — CID 102749031
3-(5-hydroxypentan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid (PubChem CID 102749031) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-(5-hydroxypentan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-(5-hydroxypentan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102749031 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-(5-hydroxypentan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)NC(C)CCCO |
| InChI | InChI=1S/C11H17NO5S2/c1-7-6-18-9(11(14)15)10(7)19(16,17)12-8(2)4-3-5-13/h6,8,12-13H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | YCECMAYNTXDIGI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |