C13H21NO4S2 — CID 102748093
3-(heptan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid (PubChem CID 102748093) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(heptan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-(heptan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102748093 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-(heptan-2-ylsulfamoyl)-4-methylthiophene-2-carboxylic acid |
| SMILES | CCCCCC(C)NS(=O)(=O)c1c(C)csc1C(=O)O |
| InChI | InChI=1S/C13H21NO4S2/c1-4-5-6-7-10(3)14-20(17,18)12-9(2)8-19-11(12)13(15)16/h8,10,14H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | DZEDMSRISLTDDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|