C10H15NO5S3 — CID 102749301
4-methyl-3-(3-methylsulfinylpropylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 102749301) has the molecular formula C10H15NO5S3 and a molecular weight of 325.43 g/mol. Its IUPAC name is 4-methyl-3-(3-methylsulfinylpropylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-(3-methylsulfinylpropylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102749301 |
| Molecular Formula | C10H15NO5S3 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 4-methyl-3-(3-methylsulfinylpropylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)NCCCS(C)=O |
| InChI | InChI=1S/C10H15NO5S3/c1-7-6-17-8(10(12)13)9(7)19(15,16)11-4-3-5-18(2)14/h6,11H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | AEBNYSRAQSMEAO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|