C11H13NO4S3 — CID 114187437
4-methyl-3-(2-prop-2-ynylsulfanylethylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 114187437) has the molecular formula C11H13NO4S3 and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-methyl-3-(2-prop-2-ynylsulfanylethylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-(2-prop-2-ynylsulfanylethylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114187437 |
| Molecular Formula | C11H13NO4S3 |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 4-methyl-3-(2-prop-2-ynylsulfanylethylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | C#CCSCCNS(=O)(=O)c1c(C)csc1C(=O)O |
| InChI | InChI=1S/C11H13NO4S3/c1-3-5-17-6-4-12-19(15,16)10-8(2)7-18-9(10)11(13)14/h1,7,12H,4-6H2,2H3,(H,13,14) |
| InChIKey | XVTBFZZMHYOMMT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|