C11H20N4O4S — CID 119501278
2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-(methylamino)ethyl]propanamide (PubChem CID 119501278) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-(methylamino)ethyl]propanamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-(methylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 119501278 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-(methylamino)ethyl]propanamide |
| SMILES | CNCCNC(=O)C(C)NS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C11H20N4O4S/c1-7-10(9(3)19-14-7)20(17,18)15-8(2)11(16)13-6-5-12-4/h8,12,15H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | XJQWLWPSYRSMMT-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|