C12H19N3O6S2 — CID 119241417
2-[2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid (PubChem CID 119241417) has the molecular formula C12H19N3O6S2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241417 |
| Molecular Formula | C12H19N3O6S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanoylamino]ethylsulfanyl]acetic acid |
| SMILES | Cc1noc(C)c1S(=O)(=O)NC(C)C(=O)NCCSCC(=O)O |
| InChI | InChI=1S/C12H19N3O6S2/c1-7-11(9(3)21-14-7)23(19,20)15-8(2)12(18)13-4-5-22-6-10(16)17/h8,15H,4-6H2,1-3H3,(H,13,18)(H,16,17) |
| InChIKey | IGPCHGAGFODFSL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|