C13H16N2O5S3 — CID 8519544
N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]thiophene-2-sulfonamide (PubChem CID 8519544) has the molecular formula C13H16N2O5S3 and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 8519544 |
| Molecular Formula | C13H16N2O5S3 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccs2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H16N2O5S3/c1-15(2)23(18,19)12-9-10(6-7-11(12)20-3)14-22(16,17)13-5-4-8-21-13/h4-9,14H,1-3H3 |
| InChIKey | WBJXMRFMEZWMIQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |