C17H20N2O5S2 — CID 9106438
N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 9106438) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 9106438 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | COc1ccc(NC(=O)CCC(=O)c2cccs2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H20N2O5S2/c1-19(2)26(22,23)16-11-12(6-8-14(16)24-3)18-17(21)9-7-13(20)15-5-4-10-25-15/h4-6,8,10-11H,7,9H2,1-3H3,(H,18,21) |
| InChIKey | RSSSEZOSRMOOMU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |