C17H20IN3O4S — CID 24658780
N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2-(2-iodoanilino)acetamide (PubChem CID 24658780) has the molecular formula C17H20IN3O4S and a molecular weight of 489.34 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2-(2-iodoanilino)acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2-(2-iodoanilino)acetamide |
|---|---|
| PubChem CID | 24658780 |
| Molecular Formula | C17H20IN3O4S |
| Molecular Weight | 489.34 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-2-(2-iodoanilino)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2ccccc2I)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H20IN3O4S/c1-21(2)26(23,24)16-10-12(8-9-15(16)25-3)20-17(22)11-19-14-7-5-4-6-13(14)18/h4-10,19H,11H2,1-3H3,(H,20,22) |
| InChIKey | SWHFKPZAKJIATG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|