C16H17IN2O3 — CID 26506677
N-(3,5-dimethoxyphenyl)-2-(2-iodoanilino)acetamide (PubChem CID 26506677) has the molecular formula C16H17IN2O3 and a molecular weight of 412.23 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-(2-iodoanilino)acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-(2-iodoanilino)acetamide |
|---|---|
| PubChem CID | 26506677 |
| Molecular Formula | C16H17IN2O3 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-(2-iodoanilino)acetamide |
| SMILES | COc1cc(NC(=O)CNc2ccccc2I)cc(OC)c1 |
| InChI | InChI=1S/C16H17IN2O3/c1-21-12-7-11(8-13(9-12)22-2)19-16(20)10-18-15-6-4-3-5-14(15)17/h3-9,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | XSTKVLZLZCFIFC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|