C16H18N2O6S2 — CID 9199427
[2-[3-(dimethylsulfamoyl)-4-methoxyanilino]-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 9199427) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)-4-methoxyanilino]-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-[3-(dimethylsulfamoyl)-4-methoxyanilino]-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 9199427 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)-4-methoxyanilino]-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cccs2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H18N2O6S2/c1-18(2)26(21,22)14-9-11(6-7-12(14)23-3)17-15(19)10-24-16(20)13-5-4-8-25-13/h4-9H,10H2,1-3H3,(H,17,19) |
| InChIKey | XBJVQTPDYGIUJD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |