C18H19FN2O6S — CID 7973222
[2-(3-fluoroanilino)-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate (PubChem CID 7973222) has the molecular formula C18H19FN2O6S and a molecular weight of 410.42 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 7973222 |
| Molecular Formula | C18H19FN2O6S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2cccc(F)c2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H19FN2O6S/c1-21(2)28(24,25)16-9-12(7-8-15(16)26-3)18(23)27-11-17(22)20-14-6-4-5-13(19)10-14/h4-10H,11H2,1-3H3,(H,20,22) |
| InChIKey | BKFQOEMFGOJGNT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |