C23H22F2N2O5S — CID 25352955
N-[3-[[3-benzyl-4-(difluoromethoxy)phenyl]sulfamoyl]-4-methoxyphenyl]acetamide (PubChem CID 25352955) has the molecular formula C23H22F2N2O5S and a molecular weight of 476.50 g/mol. Its IUPAC name is N-[3-[[3-benzyl-4-(difluoromethoxy)phenyl]sulfamoyl]-4-methoxyphenyl]acetamide.
| Compound Name | N-[3-[[3-benzyl-4-(difluoromethoxy)phenyl]sulfamoyl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 25352955 |
| Molecular Formula | C23H22F2N2O5S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[3-[[3-benzyl-4-(difluoromethoxy)phenyl]sulfamoyl]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1S(=O)(=O)Nc1ccc(OC(F)F)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H22F2N2O5S/c1-15(28)26-18-8-11-21(31-2)22(14-18)33(29,30)27-19-9-10-20(32-23(24)25)17(13-19)12-16-6-4-3-5-7-16/h3-11,13-14,23,27H,12H2,1-2H3,(H,26,28) |
| InChIKey | FDUXLHLVXBWJRW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |