C22H19F2NO3 — CID 55539818
2-benzyl-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide (PubChem CID 55539818) has the molecular formula C22H19F2NO3 and a molecular weight of 383.39 g/mol. Its IUPAC name is 2-benzyl-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide.
| Compound Name | 2-benzyl-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 55539818 |
| Molecular Formula | C22H19F2NO3 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-benzyl-N-[3-(difluoromethoxy)-4-methoxyphenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2Cc2ccccc2)cc1OC(F)F |
| InChI | InChI=1S/C22H19F2NO3/c1-27-19-12-11-17(14-20(19)28-22(23)24)25-21(26)18-10-6-5-9-16(18)13-15-7-3-2-4-8-15/h2-12,14,22H,13H2,1H3,(H,25,26) |
| InChIKey | YWVOCIIWQYIARP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |