C24H23F2NO4 — CID 18205374
N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(2,4-dimethoxyphenyl)acetamide (PubChem CID 18205374) has the molecular formula C24H23F2NO4 and a molecular weight of 427.45 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18205374 |
| Molecular Formula | C24H23F2NO4 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(OC(F)F)c(Cc3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C24H23F2NO4/c1-29-20-10-8-17(22(15-20)30-2)14-23(28)27-19-9-11-21(31-24(25)26)18(13-19)12-16-6-4-3-5-7-16/h3-11,13,15,24H,12,14H2,1-2H3,(H,27,28) |
| InChIKey | AFWVXTIZNVYLNH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |