C24H18F2N2O4 — CID 24525173
N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 24525173) has the molecular formula C24H18F2N2O4 and a molecular weight of 436.41 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 24525173 |
| Molecular Formula | C24H18F2N2O4 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc(OC(F)F)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H18F2N2O4/c25-24(26)32-20-11-10-17(13-16(20)12-15-6-2-1-3-7-15)27-21(29)14-28-22(30)18-8-4-5-9-19(18)23(28)31/h1-11,13,24H,12,14H2,(H,27,29) |
| InChIKey | JWPFCMRVAUXEPH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|