C19H15F2NO2S — CID 18228128
N-[3-benzyl-4-(difluoromethoxy)phenyl]thiophene-2-carboxamide (PubChem CID 18228128) has the molecular formula C19H15F2NO2S and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18228128 |
| Molecular Formula | C19H15F2NO2S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)c(Cc2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C19H15F2NO2S/c20-19(21)24-16-9-8-15(22-18(23)17-7-4-10-25-17)12-14(16)11-13-5-2-1-3-6-13/h1-10,12,19H,11H2,(H,22,23) |
| InChIKey | QZAWATMJKBELOM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |