C23H21F2N3O3 — CID 24533543
N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-[(carbamoylamino)methyl]benzamide (PubChem CID 24533543) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-[(carbamoylamino)methyl]benzamide.
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-[(carbamoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 24533543 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-[(carbamoylamino)methyl]benzamide |
| SMILES | NC(=O)NCc1ccc(C(=O)Nc2ccc(OC(F)F)c(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H21F2N3O3/c24-22(25)31-20-11-10-19(13-18(20)12-15-4-2-1-3-5-15)28-21(29)17-8-6-16(7-9-17)14-27-23(26)30/h1-11,13,22H,12,14H2,(H,28,29)(H3,26,27,30) |
| InChIKey | HYSLFHUGQUOYPW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |