C22H18F2N2O3 — CID 24659050
4-benzamido-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide (PubChem CID 24659050) has the molecular formula C22H18F2N2O3 and a molecular weight of 396.39 g/mol. Its IUPAC name is 4-benzamido-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-benzamido-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 24659050 |
| Molecular Formula | C22H18F2N2O3 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-benzamido-N-[[2-(difluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1OC(F)F)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18F2N2O3/c23-22(24)29-19-9-5-4-8-17(19)14-25-20(27)16-10-12-18(13-11-16)26-21(28)15-6-2-1-3-7-15/h1-13,22H,14H2,(H,25,27)(H,26,28) |
| InChIKey | QGTJEOJQRLVKRV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |