C23H19BrF2N2O3 — CID 60615050
3-benzamido-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-4-methylbenzamide (PubChem CID 60615050) has the molecular formula C23H19BrF2N2O3 and a molecular weight of 489.32 g/mol. Its IUPAC name is 3-benzamido-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-4-methylbenzamide.
| Compound Name | 3-benzamido-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 60615050 |
| Molecular Formula | C23H19BrF2N2O3 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 3-benzamido-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cc(Br)ccc2OC(F)F)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19BrF2N2O3/c1-14-7-8-16(12-19(14)28-22(30)15-5-3-2-4-6-15)21(29)27-13-17-11-18(24)9-10-20(17)31-23(25)26/h2-12,23H,13H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | QJYBBTJNHBMSLA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |