C15H14BrNO2 — CID 49172987
N-[(5-bromo-2-methoxyphenyl)methyl]benzamide (PubChem CID 49172987) has the molecular formula C15H14BrNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]benzamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 49172987 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14BrNO2/c1-19-14-8-7-13(16)9-12(14)10-17-15(18)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,17,18) |
| InChIKey | DCTFAOCADQFOBK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |