C16H14BrN3O2 — CID 46341642
N-[(5-bromo-2-methoxyphenyl)methyl]-1H-indazole-6-carboxamide (PubChem CID 46341642) has the molecular formula C16H14BrN3O2 and a molecular weight of 360.21 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-1H-indazole-6-carboxamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 46341642 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-1H-indazole-6-carboxamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C16H14BrN3O2/c1-22-15-5-4-13(17)6-12(15)8-18-16(21)10-2-3-11-9-19-20-14(11)7-10/h2-7,9H,8H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | RGYXUHLPDHFBHX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |