C12H10N4OS — CID 62905804
N-(1,3-thiazol-2-ylmethyl)-1H-indazole-6-carboxamide (PubChem CID 62905804) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is N-(1,3-thiazol-2-ylmethyl)-1H-indazole-6-carboxamide.
| Compound Name | N-(1,3-thiazol-2-ylmethyl)-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 62905804 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(1,3-thiazol-2-ylmethyl)-1H-indazole-6-carboxamide |
| SMILES | O=C(NCc1nccs1)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C12H10N4OS/c17-12(14-7-11-13-3-4-18-11)8-1-2-9-6-15-16-10(9)5-8/h1-6H,7H2,(H,14,17)(H,15,16) |
| InChIKey | ZBZJPVLXZCVGLQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |