C14H16N4O — CID 114693720
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-indazole-6-carboxamide (PubChem CID 114693720) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-indazole-6-carboxamide.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 114693720 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-indazole-6-carboxamide |
| SMILES | O=C(NCC1=CCNCC1)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C14H16N4O/c19-14(16-8-10-3-5-15-6-4-10)11-1-2-12-9-17-18-13(12)7-11/h1-3,7,9,15H,4-6,8H2,(H,16,19)(H,17,18) |
| InChIKey | RGCZQIMXVDUMMD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|