C13H14BrFN2O — CID 104954975
3-bromo-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide (PubChem CID 104954975) has the molecular formula C13H14BrFN2O and a molecular weight of 313.17 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide.
| Compound Name | 3-bromo-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 104954975 |
| Molecular Formula | C13H14BrFN2O |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-bromo-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1=CCNCC1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H14BrFN2O/c14-11-7-10(1-2-12(11)15)13(18)17-8-9-3-5-16-6-4-9/h1-3,7,16H,4-6,8H2,(H,17,18) |
| InChIKey | LAYHWXMBRHCINV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|