C13H14ClIN2O — CID 104954986
3-chloro-4-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide (PubChem CID 104954986) has the molecular formula C13H14ClIN2O and a molecular weight of 376.63 g/mol. Its IUPAC name is 3-chloro-4-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide.
| Compound Name | 3-chloro-4-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 104954986 |
| Molecular Formula | C13H14ClIN2O |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 3-chloro-4-iodo-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1=CCNCC1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H14ClIN2O/c14-11-7-10(1-2-12(11)15)13(18)17-8-9-3-5-16-6-4-9/h1-3,7,16H,4-6,8H2,(H,17,18) |
| InChIKey | WELFDTNUHVYNJV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|