C14H17ClN2O — CID 107098368
3-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide (PubChem CID 107098368) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide.
| Compound Name | 3-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107098368 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-chloro-2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
| SMILES | Cc1c(Cl)cccc1C(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C14H17ClN2O/c1-10-12(3-2-4-13(10)15)14(18)17-9-11-5-7-16-8-6-11/h2-5,16H,6-9H2,1H3,(H,17,18) |
| InChIKey | GDFYEYQPJKBUCM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|