C13H15ClN2O — CID 114693546
2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide (PubChem CID 114693546) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide.
| Compound Name | 2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 114693546 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-chloro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1=CCNCC1)c1ccccc1Cl |
| InChI | InChI=1S/C13H15ClN2O/c14-12-4-2-1-3-11(12)13(17)16-9-10-5-7-15-8-6-10/h1-5,15H,6-9H2,(H,16,17) |
| InChIKey | VOWFGFKTBJGIMH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|