C9H14N2O — CID 114693829
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)prop-2-enamide (PubChem CID 114693829) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)prop-2-enamide.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 114693829 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C9H14N2O/c1-2-9(12)11-7-8-3-5-10-6-4-8/h2-3,10H,1,4-7H2,(H,11,12) |
| InChIKey | VLVZEDCUFOMHAS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|