C11H18N2O — CID 107486630
(E)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]but-2-enamide (PubChem CID 107486630) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (E)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]but-2-enamide.
| Compound Name | (E)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 107486630 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (E)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCC1=CCNCC1 |
| InChI | InChI=1S/C11H18N2O/c1-2-3-11(14)13-9-6-10-4-7-12-8-5-10/h2-4,12H,5-9H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | DHFAMIPIWCONCP-NSCUHMNNSA-N |
| XLogP | 0.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|