C9H16N2O — CID 107486741
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide (PubChem CID 107486741) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 107486741 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCC1=CCNCC1 |
| InChI | InChI=1S/C9H16N2O/c1-8(12)11-7-4-9-2-5-10-6-3-9/h2,10H,3-7H2,1H3,(H,11,12) |
| InChIKey | IFAVTVBOIADMLL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|