C9H13N5O — CID 114693994
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 114693994) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 114693994 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NCC1=CCNCC1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H13N5O/c15-9(8-12-6-13-14-8)11-5-7-1-3-10-4-2-7/h1,6,10H,2-5H2,(H,11,15)(H,12,13,14) |
| InChIKey | CFOFXEDVMSBQGP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|