C5H6F2N4O — CID 115283347
N-(2,2-difluoroethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 115283347) has the molecular formula C5H6F2N4O and a molecular weight of 176.13 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 115283347 |
| Molecular Formula | C5H6F2N4O |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NCC(F)F)c1ncn[nH]1 |
| InChI | InChI=1S/C5H6F2N4O/c6-3(7)1-8-5(12)4-9-2-10-11-4/h2-3H,1H2,(H,8,12)(H,9,10,11) |
| InChIKey | DGBJYWXEOIWLON-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |