C9H16N4O — CID 115749130
N-(2-ethylbutyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 115749130) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(2-ethylbutyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2-ethylbutyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 115749130 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-(2-ethylbutyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCC(CC)CNC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4O/c1-3-7(4-2)5-10-9(14)8-11-6-12-13-8/h6-7H,3-5H2,1-2H3,(H,10,14)(H,11,12,13) |
| InChIKey | QMRWNZYYAITHPO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |